C19H17F2NO4S — CID 123935726
[4-(2,4-difluorophenyl)-2-methylsulfanylcarbonylphenyl] 2-acetamidopropanoate (PubChem CID 123935726) has the molecular formula C19H17F2NO4S and a molecular weight of 393.41 g/mol. Its IUPAC name is [4-(2,4-difluorophenyl)-2-methylsulfanylcarbonylphenyl] 2-acetamidopropanoate.
| Compound Name | [4-(2,4-difluorophenyl)-2-methylsulfanylcarbonylphenyl] 2-acetamidopropanoate |
|---|---|
| PubChem CID | 123935726 |
| Molecular Formula | C19H17F2NO4S |
| Molecular Weight | 393.41 g/mol |
| Exact Mass | 393.08 |
| IUPAC Name | [4-(2,4-difluorophenyl)-2-methylsulfanylcarbonylphenyl] 2-acetamidopropanoate |
| SMILES | CSC(=O)c1cc(-c2ccc(F)cc2F)ccc1OC(=O)C(C)NC(C)=O |
| InChI | InChI=1S/C19H17F2NO4S/c1-10(22-11(2)23)18(24)26-17-7-4-12(8-15(17)19(25)27-3)14-6-5-13(20)9-16(14)21/h4-10H,1-3H3,(H,22,23) |
| InChIKey | QZJYZXQXGCIBAP-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.41 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|