C21H28O5 — CID 157098562
4-methyl-2-[(Z)-2-(2-methylpropyl)-4-oxonon-6-enoyl]oxybenzoic acid (PubChem CID 157098562) has the molecular formula C21H28O5 and a molecular weight of 360.45 g/mol. Its IUPAC name is 4-methyl-2-[(Z)-2-(2-methylpropyl)-4-oxonon-6-enoyl]oxybenzoic acid.
| Compound Name | 4-methyl-2-[(Z)-2-(2-methylpropyl)-4-oxonon-6-enoyl]oxybenzoic acid |
|---|---|
| PubChem CID | 157098562 |
| Molecular Formula | C21H28O5 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.19 |
| IUPAC Name | 4-methyl-2-[(Z)-2-(2-methylpropyl)-4-oxonon-6-enoyl]oxybenzoic acid |
| SMILES | CC/C=C\CC(=O)CC(CC(C)C)C(=O)Oc1cc(C)ccc1C(=O)O |
| InChI | InChI=1S/C21H28O5/c1-5-6-7-8-17(22)13-16(11-14(2)3)21(25)26-19-12-15(4)9-10-18(19)20(23)24/h6-7,9-10,12,14,16H,5,8,11,13H2,1-4H3,(H,23,24)/b7-6- |
| InChIKey | SGMGKRYDMDTUMG-SREVYHEPSA-N |
| XLogP | 4.58 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|