C23H22F2O5 — CID 59193347
5-(3,5-difluorophenyl)-2-[(Z)-2-methyl-4-oxonon-6-enoyl]oxybenzoic acid (PubChem CID 59193347) has the molecular formula C23H22F2O5 and a molecular weight of 416.42 g/mol. Its IUPAC name is 5-(3,5-difluorophenyl)-2-[(Z)-2-methyl-4-oxonon-6-enoyl]oxybenzoic acid.
| Compound Name | 5-(3,5-difluorophenyl)-2-[(Z)-2-methyl-4-oxonon-6-enoyl]oxybenzoic acid |
|---|---|
| PubChem CID | 59193347 |
| Molecular Formula | C23H22F2O5 |
| Molecular Weight | 416.42 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | 5-(3,5-difluorophenyl)-2-[(Z)-2-methyl-4-oxonon-6-enoyl]oxybenzoic acid |
| SMILES | CC/C=C\CC(=O)CC(C)C(=O)Oc1ccc(-c2cc(F)cc(F)c2)cc1C(=O)O |
| InChI | InChI=1S/C23H22F2O5/c1-3-4-5-6-19(26)9-14(2)23(29)30-21-8-7-15(12-20(21)22(27)28)16-10-17(24)13-18(25)11-16/h4-5,7-8,10-14H,3,6,9H2,1-2H3,(H,27,28)/b5-4- |
| InChIKey | KWLKRTMCWTWDSF-PLNGDYQASA-N |
| XLogP | 5.19 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.42 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|