C26H34N4O3 — CID 142183864
4-(4-amino-2-methylphenoxy)butyl prop-2-enoate;aniline;benzene-1,4-diamine (PubChem CID 142183864) has the molecular formula C26H34N4O3 and a molecular weight of 450.58 g/mol. Its IUPAC name is 4-(4-amino-2-methylphenoxy)butyl prop-2-enoate;aniline;benzene-1,4-diamine.
| Compound Name | 4-(4-amino-2-methylphenoxy)butyl prop-2-enoate;aniline;benzene-1,4-diamine |
|---|---|
| PubChem CID | 142183864 |
| Molecular Formula | C26H34N4O3 |
| Molecular Weight | 450.58 g/mol |
| Exact Mass | 450.26 |
| IUPAC Name | 4-(4-amino-2-methylphenoxy)butyl prop-2-enoate;aniline;benzene-1,4-diamine |
| SMILES | C=CC(=O)OCCCCOc1ccc(N)cc1C.Nc1ccc(N)cc1.Nc1ccccc1 |
| InChI | InChI=1S/C14H19NO3.C6H8N2.C6H7N/c1-3-14(16)18-9-5-4-8-17-13-7-6-12(15)10-11(13)2;7-5-1-2-6(8)4-3-5;7-6-4-2-1-3-5-6/h3,6-7,10H,1,4-5,8-9,15H2,2H3;1-4H,7-8H2;1-5H,7H2 |
| InChIKey | GXBDXJURDGSTIG-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 139.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.58 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|