C23H16F22N2O6 — CID 154181812
[3,3,4,4-tetrafluoro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yloxy)butyl] N-[2-methyl-5-[[3,3,4,4-tetrafluoro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yloxy)butoxy]carbonylamino]phenyl]carbamate (PubChem CID 154181812) has the molecular formula C23H16F22N2O6 and a molecular weight of 834.34 g/mol. Its IUPAC name is [3,3,4,4-tetrafluoro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yloxy)butyl] N-[2-methyl-5-[[3,3,4,4-tetrafluoro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yloxy)butoxy]carbonylamino]phenyl]carbamate.
| Compound Name | [3,3,4,4-tetrafluoro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yloxy)butyl] N-[2-methyl-5-[[3,3,4,4-tetrafluoro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yloxy)butoxy]carbonylamino]phenyl]carbamate |
|---|---|
| PubChem CID | 154181812 |
| Molecular Formula | C23H16F22N2O6 |
| Molecular Weight | 834.34 g/mol |
| Exact Mass | 834.07 |
| IUPAC Name | [3,3,4,4-tetrafluoro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yloxy)butyl] N-[2-methyl-5-[[3,3,4,4-tetrafluoro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yloxy)butoxy]carbonylamino]phenyl]carbamate |
| SMILES | Cc1ccc(NC(=O)OCCC(F)(F)C(F)(F)OC(F)(C(F)(F)F)C(F)(F)F)cc1NC(=O)OCCC(F)(F)C(F)(F)OC(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C23H16F22N2O6/c1-9-2-3-10(46-12(48)50-6-4-14(24,25)22(42,43)52-16(28,18(30,31)32)19(33,34)35)8-11(9)47-13(49)51-7-5-15(26,27)23(44,45)53-17(29,20(36,37)38)21(39,40)41/h2-3,8H,4-7H2,1H3,(H,46,48)(H,47,49) |
| InChIKey | XJBLQQVHXKMICA-UHFFFAOYSA-N |
| XLogP | 9.94 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 834.34 |
| LogP ≤ 5 | 9.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|