About 4-chloro-2-fluoro-5-methylaniline;phenyl N-(4-chloro-2-fluoro-5-methylphenyl)carbamate
4-chloro-2-fluoro-5-methylaniline;phenyl N-(4-chloro-2-fluoro-5-methylphenyl)carbamate (PubChem CID 70115366) has the molecular formula C21H18Cl2F2N2O2
and a molecular weight of 439.29 g/mol. Its IUPAC name is 4-chloro-2-fluoro-5-methylaniline;phenyl N-(4-chloro-2-fluoro-5-methylphenyl)carbamate.
Molecular Properties
| Compound Name | 4-chloro-2-fluoro-5-methylaniline;phenyl N-(4-chloro-2-fluoro-5-methylphenyl)carbamate |
| PubChem CID | 70115366 |
| Molecular Formula | C21H18Cl2F2N2O2 |
| Molecular Weight | 439.29 g/mol |
| Exact Mass | 438.07 |
| IUPAC Name | 4-chloro-2-fluoro-5-methylaniline;phenyl N-(4-chloro-2-fluoro-5-methylphenyl)carbamate |
| SMILES | Cc1cc(N)c(F)cc1Cl.Cc1cc(NC(=O)Oc2ccccc2)c(F)cc1Cl |
| InChI | InChI=1S/C14H11ClFNO2.C7H7ClFN/c1-9-7-13(12(16)8-11(9)15)17-14(18)19-10-5-3-2-4-6-10;1-4-2-7(10)6(9)3-5(4)8/h2-8H,1H3,(H,17,18);2-3H,10H2,1H3 |
| InChIKey | CFFCXQAUNNTOCH-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 439.29 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-2-fluoro-5-methylaniline;phenyl N-(4-chloro-2-fluoro-5-methylphenyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-2-fluoro-5-methylaniline;phenyl N-(4-chloro-2-fluoro-5-methylphenyl)carbamate?
The IUPAC name of 4-chloro-2-fluoro-5-methylaniline;phenyl N-(4-chloro-2-fluoro-5-methylphenyl)carbamate (CID 70115366) is 4-chloro-2-fluoro-5-methylaniline;phenyl N-(4-chloro-2-fluoro-5-methylphenyl)carbamate.
What is the SMILES notation for 4-chloro-2-fluoro-5-methylaniline;phenyl N-(4-chloro-2-fluoro-5-methylphenyl)carbamate?
The canonical SMILES for 4-chloro-2-fluoro-5-methylaniline;phenyl N-(4-chloro-2-fluoro-5-methylphenyl)carbamate is Cc1cc(N)c(F)cc1Cl.Cc1cc(NC(=O)Oc2ccccc2)c(F)cc1Cl.
What is the InChIKey of 4-chloro-2-fluoro-5-methylaniline;phenyl N-(4-chloro-2-fluoro-5-methylphenyl)carbamate?
The InChIKey is CFFCXQAUNNTOCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11ClFNO2.C7H7ClFN/c1-9-7-13(12(16)8-11(9)15)17-14(18)19-10-5-3-2-4-6-10;1-4-2-7(10)6(9)3-5(4)8/h2-8H,1H3,(H,17,18);2-3H,10H2,1H3.
What are the key properties of 4-chloro-2-fluoro-5-methylaniline;phenyl N-(4-chloro-2-fluoro-5-methylphenyl)carbamate?
4-chloro-2-fluoro-5-methylaniline;phenyl N-(4-chloro-2-fluoro-5-methylphenyl)carbamate has a molecular weight of 439.29 g/mol, XLogP of 6.77, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2-fluoro-5-methylaniline;phenyl N-(4-chloro-2-fluoro-5-methylphenyl)carbamate is sourced from PubChem (CID 70115366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).