About phenyl N-benzoylcarbamate
phenyl N-benzoylcarbamate (PubChem CID 66560330) has the molecular formula C14H11NO3
and a molecular weight of 241.25 g/mol. Its IUPAC name is phenyl N-benzoylcarbamate.
Molecular Properties
| Compound Name | phenyl N-benzoylcarbamate |
| PubChem CID | 66560330 |
| Molecular Formula | C14H11NO3 |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.07 |
| IUPAC Name | phenyl N-benzoylcarbamate |
| SMILES | O=C(NC(=O)c1ccccc1)Oc1ccccc1 |
| InChI | InChI=1S/C14H11NO3/c16-13(11-7-3-1-4-8-11)15-14(17)18-12-9-5-2-6-10-12/h1-10H,(H,15,16,17) |
| InChIKey | ZPQRIKRZFGKJII-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze phenyl N-benzoylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl N-benzoylcarbamate?
The IUPAC name of phenyl N-benzoylcarbamate (CID 66560330) is phenyl N-benzoylcarbamate.
What is the SMILES notation for phenyl N-benzoylcarbamate?
The canonical SMILES for phenyl N-benzoylcarbamate is O=C(NC(=O)c1ccccc1)Oc1ccccc1.
What is the InChIKey of phenyl N-benzoylcarbamate?
The InChIKey is ZPQRIKRZFGKJII-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11NO3/c16-13(11-7-3-1-4-8-11)15-14(17)18-12-9-5-2-6-10-12/h1-10H,(H,15,16,17).
What are the key properties of phenyl N-benzoylcarbamate?
phenyl N-benzoylcarbamate has a molecular weight of 241.25 g/mol, XLogP of 2.62, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl N-benzoylcarbamate is sourced from PubChem (CID 66560330), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).