C12H5Cl3F4N2 — CID 102750491
3,5,6-trichloro-N-[4-fluoro-3-(trifluoromethyl)phenyl]pyridin-2-amine (PubChem CID 102750491) has the molecular formula C12H5Cl3F4N2 and a molecular weight of 359.54 g/mol. Its IUPAC name is 3,5,6-trichloro-N-[4-fluoro-3-(trifluoromethyl)phenyl]pyridin-2-amine.
| Compound Name | 3,5,6-trichloro-N-[4-fluoro-3-(trifluoromethyl)phenyl]pyridin-2-amine |
|---|---|
| PubChem CID | 102750491 |
| Molecular Formula | C12H5Cl3F4N2 |
| Molecular Weight | 359.54 g/mol |
| Exact Mass | 357.95 |
| IUPAC Name | 3,5,6-trichloro-N-[4-fluoro-3-(trifluoromethyl)phenyl]pyridin-2-amine |
| SMILES | Fc1ccc(Nc2nc(Cl)c(Cl)cc2Cl)cc1C(F)(F)F |
| InChI | InChI=1S/C12H5Cl3F4N2/c13-7-4-8(14)11(21-10(7)15)20-5-1-2-9(16)6(3-5)12(17,18)19/h1-4H,(H,20,21) |
| InChIKey | UYRADQJSILTQHG-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.54 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|