C13H10ClF4N3 — CID 63729623
6-chloro-5-ethyl-N-[4-fluoro-3-(trifluoromethyl)phenyl]pyrimidin-4-amine (PubChem CID 63729623) has the molecular formula C13H10ClF4N3 and a molecular weight of 319.69 g/mol. Its IUPAC name is 6-chloro-5-ethyl-N-[4-fluoro-3-(trifluoromethyl)phenyl]pyrimidin-4-amine.
| Compound Name | 6-chloro-5-ethyl-N-[4-fluoro-3-(trifluoromethyl)phenyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 63729623 |
| Molecular Formula | C13H10ClF4N3 |
| Molecular Weight | 319.69 g/mol |
| Exact Mass | 319.05 |
| IUPAC Name | 6-chloro-5-ethyl-N-[4-fluoro-3-(trifluoromethyl)phenyl]pyrimidin-4-amine |
| SMILES | CCc1c(Cl)ncnc1Nc1ccc(F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H10ClF4N3/c1-2-8-11(14)19-6-20-12(8)21-7-3-4-10(15)9(5-7)13(16,17)18/h3-6H,2H2,1H3,(H,19,20,21) |
| InChIKey | ASXFSLJQDJQGHD-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.69 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |