About N-(6-bromonaphthalen-2-yl)-4-chloro-1,2,5-thiadiazol-3-amine
N-(6-bromonaphthalen-2-yl)-4-chloro-1,2,5-thiadiazol-3-amine (PubChem CID 81260117) has the molecular formula C12H7BrClN3S
and a molecular weight of 340.63 g/mol. Its IUPAC name is N-(6-bromonaphthalen-2-yl)-4-chloro-1,2,5-thiadiazol-3-amine.
Molecular Properties
| Compound Name | N-(6-bromonaphthalen-2-yl)-4-chloro-1,2,5-thiadiazol-3-amine |
| PubChem CID | 81260117 |
| Molecular Formula | C12H7BrClN3S |
| Molecular Weight | 340.63 g/mol |
| Exact Mass | 338.92 |
| IUPAC Name | N-(6-bromonaphthalen-2-yl)-4-chloro-1,2,5-thiadiazol-3-amine |
| SMILES | Clc1nsnc1Nc1ccc2cc(Br)ccc2c1 |
| InChI | InChI=1S/C12H7BrClN3S/c13-9-3-1-8-6-10(4-2-7(8)5-9)15-12-11(14)16-18-17-12/h1-6H,(H,15,17) |
| InChIKey | ULRFFXLZCDBCJX-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.63 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(6-bromonaphthalen-2-yl)-4-chloro-1,2,5-thiadiazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(6-bromonaphthalen-2-yl)-4-chloro-1,2,5-thiadiazol-3-amine?
The IUPAC name of N-(6-bromonaphthalen-2-yl)-4-chloro-1,2,5-thiadiazol-3-amine (CID 81260117) is N-(6-bromonaphthalen-2-yl)-4-chloro-1,2,5-thiadiazol-3-amine.
What is the SMILES notation for N-(6-bromonaphthalen-2-yl)-4-chloro-1,2,5-thiadiazol-3-amine?
The canonical SMILES for N-(6-bromonaphthalen-2-yl)-4-chloro-1,2,5-thiadiazol-3-amine is Clc1nsnc1Nc1ccc2cc(Br)ccc2c1.
What is the InChIKey of N-(6-bromonaphthalen-2-yl)-4-chloro-1,2,5-thiadiazol-3-amine?
The InChIKey is ULRFFXLZCDBCJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7BrClN3S/c13-9-3-1-8-6-10(4-2-7(8)5-9)15-12-11(14)16-18-17-12/h1-6H,(H,15,17).
What are the key properties of N-(6-bromonaphthalen-2-yl)-4-chloro-1,2,5-thiadiazol-3-amine?
N-(6-bromonaphthalen-2-yl)-4-chloro-1,2,5-thiadiazol-3-amine has a molecular weight of 340.63 g/mol, XLogP of 4.85, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(6-bromonaphthalen-2-yl)-4-chloro-1,2,5-thiadiazol-3-amine is sourced from PubChem (CID 81260117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).