C12H10ClF2N3 — CID 82815662
5-chloro-2-N-(2,6-difluoro-3-methylphenyl)pyridine-2,3-diamine (PubChem CID 82815662) has the molecular formula C12H10ClF2N3 and a molecular weight of 269.68 g/mol. Its IUPAC name is 5-chloro-2-N-(2,6-difluoro-3-methylphenyl)pyridine-2,3-diamine.
| Compound Name | 5-chloro-2-N-(2,6-difluoro-3-methylphenyl)pyridine-2,3-diamine |
|---|---|
| PubChem CID | 82815662 |
| Molecular Formula | C12H10ClF2N3 |
| Molecular Weight | 269.68 g/mol |
| Exact Mass | 269.05 |
| IUPAC Name | 5-chloro-2-N-(2,6-difluoro-3-methylphenyl)pyridine-2,3-diamine |
| SMILES | Cc1ccc(F)c(Nc2ncc(Cl)cc2N)c1F |
| InChI | InChI=1S/C12H10ClF2N3/c1-6-2-3-8(14)11(10(6)15)18-12-9(16)4-7(13)5-17-12/h2-5H,16H2,1H3,(H,17,18) |
| InChIKey | WOQSOPPUCJAWIW-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.68 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |