C11H6ClF3N2 — CID 79727964
5-chloro-N-(2,6-difluorophenyl)-3-fluoropyridin-2-amine (PubChem CID 79727964) has the molecular formula C11H6ClF3N2 and a molecular weight of 258.63 g/mol. Its IUPAC name is 5-chloro-N-(2,6-difluorophenyl)-3-fluoropyridin-2-amine.
| Compound Name | 5-chloro-N-(2,6-difluorophenyl)-3-fluoropyridin-2-amine |
|---|---|
| PubChem CID | 79727964 |
| Molecular Formula | C11H6ClF3N2 |
| Molecular Weight | 258.63 g/mol |
| Exact Mass | 258.02 |
| IUPAC Name | 5-chloro-N-(2,6-difluorophenyl)-3-fluoropyridin-2-amine |
| SMILES | Fc1cc(Cl)cnc1Nc1c(F)cccc1F |
| InChI | InChI=1S/C11H6ClF3N2/c12-6-4-9(15)11(16-5-6)17-10-7(13)2-1-3-8(10)14/h1-5H,(H,16,17) |
| InChIKey | ZZXCQTFKQGJXFQ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.63 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |