C13H9ClFN3O — CID 107469806
2-[(5-chloro-3-fluoro-2-pyridinyl)amino]-3-methoxybenzonitrile (PubChem CID 107469806) has the molecular formula C13H9ClFN3O and a molecular weight of 277.69 g/mol. Its IUPAC name is 2-[(5-chloro-3-fluoro-2-pyridinyl)amino]-3-methoxybenzonitrile.
| Compound Name | 2-[(5-chloro-3-fluoro-2-pyridinyl)amino]-3-methoxybenzonitrile |
|---|---|
| PubChem CID | 107469806 |
| Molecular Formula | C13H9ClFN3O |
| Molecular Weight | 277.69 g/mol |
| Exact Mass | 277.04 |
| IUPAC Name | 2-[(5-chloro-3-fluoro-2-pyridinyl)amino]-3-methoxybenzonitrile |
| SMILES | COc1cccc(C#N)c1Nc1ncc(Cl)cc1F |
| InChI | InChI=1S/C13H9ClFN3O/c1-19-11-4-2-3-8(6-16)12(11)18-13-10(15)5-9(14)7-17-13/h2-5,7H,1H3,(H,17,18) |
| InChIKey | LFHFQKJGIOQJSY-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 57.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.69 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |