C12H9BrN4O — CID 107469799
2-[(5-bromopyrimidin-4-yl)amino]-3-methoxybenzonitrile (PubChem CID 107469799) has the molecular formula C12H9BrN4O and a molecular weight of 305.14 g/mol. Its IUPAC name is 2-[(5-bromopyrimidin-4-yl)amino]-3-methoxybenzonitrile.
| Compound Name | 2-[(5-bromopyrimidin-4-yl)amino]-3-methoxybenzonitrile |
|---|---|
| PubChem CID | 107469799 |
| Molecular Formula | C12H9BrN4O |
| Molecular Weight | 305.14 g/mol |
| Exact Mass | 304.00 |
| IUPAC Name | 2-[(5-bromopyrimidin-4-yl)amino]-3-methoxybenzonitrile |
| SMILES | COc1cccc(C#N)c1Nc1ncncc1Br |
| InChI | InChI=1S/C12H9BrN4O/c1-18-10-4-2-3-8(5-14)11(10)17-12-9(13)6-15-7-16-12/h2-4,6-7H,1H3,(H,15,16,17) |
| InChIKey | NDVLHLACYXAMMC-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.14 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |