C10H6Br3N3 — CID 107603072
5-bromo-N-(2,6-dibromophenyl)pyrimidin-4-amine (PubChem CID 107603072) has the molecular formula C10H6Br3N3 and a molecular weight of 407.89 g/mol. Its IUPAC name is 5-bromo-N-(2,6-dibromophenyl)pyrimidin-4-amine.
| Compound Name | 5-bromo-N-(2,6-dibromophenyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 107603072 |
| Molecular Formula | C10H6Br3N3 |
| Molecular Weight | 407.89 g/mol |
| Exact Mass | 404.81 |
| IUPAC Name | 5-bromo-N-(2,6-dibromophenyl)pyrimidin-4-amine |
| SMILES | Brc1cncnc1Nc1c(Br)cccc1Br |
| InChI | InChI=1S/C10H6Br3N3/c11-6-2-1-3-7(12)9(6)16-10-8(13)4-14-5-15-10/h1-5H,(H,14,15,16) |
| InChIKey | HHZOZMBUFQFWGW-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.89 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |