C10H9BrN4 — CID 66339869
4-N-(5-bromopyrimidin-4-yl)benzene-1,4-diamine (PubChem CID 66339869) has the molecular formula C10H9BrN4 and a molecular weight of 265.11 g/mol. Its IUPAC name is 4-N-(5-bromopyrimidin-4-yl)benzene-1,4-diamine.
| Compound Name | 4-N-(5-bromopyrimidin-4-yl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 66339869 |
| Molecular Formula | C10H9BrN4 |
| Molecular Weight | 265.11 g/mol |
| Exact Mass | 264.00 |
| IUPAC Name | 4-N-(5-bromopyrimidin-4-yl)benzene-1,4-diamine |
| SMILES | Nc1ccc(Nc2ncncc2Br)cc1 |
| InChI | InChI=1S/C10H9BrN4/c11-9-5-13-6-14-10(9)15-8-3-1-7(12)2-4-8/h1-6H,12H2,(H,13,14,15) |
| InChIKey | DANVEYQXOHGXSJ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.11 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|