C25H24ClN5O — CID 167604088
3-(1-aminoisoquinolin-6-yl)-1-[5-chloro-2-[4-(dimethylamino)anilino]-3-pyridinyl]propan-1-one (PubChem CID 167604088) has the molecular formula C25H24ClN5O and a molecular weight of 445.95 g/mol. Its IUPAC name is 3-(1-aminoisoquinolin-6-yl)-1-[5-chloro-2-[4-(dimethylamino)anilino]-3-pyridinyl]propan-1-one.
| Compound Name | 3-(1-aminoisoquinolin-6-yl)-1-[5-chloro-2-[4-(dimethylamino)anilino]-3-pyridinyl]propan-1-one |
|---|---|
| PubChem CID | 167604088 |
| Molecular Formula | C25H24ClN5O |
| Molecular Weight | 445.95 g/mol |
| Exact Mass | 445.17 |
| IUPAC Name | 3-(1-aminoisoquinolin-6-yl)-1-[5-chloro-2-[4-(dimethylamino)anilino]-3-pyridinyl]propan-1-one |
| SMILES | CN(C)c1ccc(Nc2ncc(Cl)cc2C(=O)CCc2ccc3c(N)nccc3c2)cc1 |
| InChI | InChI=1S/C25H24ClN5O/c1-31(2)20-7-5-19(6-8-20)30-25-22(14-18(26)15-29-25)23(32)10-4-16-3-9-21-17(13-16)11-12-28-24(21)27/h3,5-9,11-15H,4,10H2,1-2H3,(H2,27,28)(H,29,30) |
| InChIKey | KDKSOXZFHBQFBZ-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.95 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|