C25H31ClN6O — CID 167534824
3-(1-aminoisoquinolin-6-yl)-1-[5-chloro-6-[3-(4-methylpiperazin-1-yl)propylamino]-3-pyridinyl]propan-1-one (PubChem CID 167534824) has the molecular formula C25H31ClN6O and a molecular weight of 467.02 g/mol. Its IUPAC name is 3-(1-aminoisoquinolin-6-yl)-1-[5-chloro-6-[3-(4-methylpiperazin-1-yl)propylamino]-3-pyridinyl]propan-1-one.
| Compound Name | 3-(1-aminoisoquinolin-6-yl)-1-[5-chloro-6-[3-(4-methylpiperazin-1-yl)propylamino]-3-pyridinyl]propan-1-one |
|---|---|
| PubChem CID | 167534824 |
| Molecular Formula | C25H31ClN6O |
| Molecular Weight | 467.02 g/mol |
| Exact Mass | 466.22 |
| IUPAC Name | 3-(1-aminoisoquinolin-6-yl)-1-[5-chloro-6-[3-(4-methylpiperazin-1-yl)propylamino]-3-pyridinyl]propan-1-one |
| SMILES | CN1CCN(CCCNc2ncc(C(=O)CCc3ccc4c(N)nccc4c3)cc2Cl)CC1 |
| InChI | InChI=1S/C25H31ClN6O/c1-31-11-13-32(14-12-31)10-2-8-29-25-22(26)16-20(17-30-25)23(33)6-4-18-3-5-21-19(15-18)7-9-28-24(21)27/h3,5,7,9,15-17H,2,4,6,8,10-14H2,1H3,(H2,27,28)(H,29,30) |
| InChIKey | MUSWAHWXSBBGQA-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.02 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|