C25H37N5O2 — CID 167578272
(2R)-2-amino-N-[(2S)-5-(1-aminoisoquinolin-6-yl)-3-oxopentan-2-yl]-6-piperidin-1-ylhexanamide (PubChem CID 167578272) has the molecular formula C25H37N5O2 and a molecular weight of 439.60 g/mol. Its IUPAC name is (2R)-2-amino-N-[(2S)-5-(1-aminoisoquinolin-6-yl)-3-oxopentan-2-yl]-6-piperidin-1-ylhexanamide.
| Compound Name | (2R)-2-amino-N-[(2S)-5-(1-aminoisoquinolin-6-yl)-3-oxopentan-2-yl]-6-piperidin-1-ylhexanamide |
|---|---|
| PubChem CID | 167578272 |
| Molecular Formula | C25H37N5O2 |
| Molecular Weight | 439.60 g/mol |
| Exact Mass | 439.29 |
| IUPAC Name | (2R)-2-amino-N-[(2S)-5-(1-aminoisoquinolin-6-yl)-3-oxopentan-2-yl]-6-piperidin-1-ylhexanamide |
| SMILES | C[C@H](NC(=O)[C@H](N)CCCCN1CCCCC1)C(=O)CCc1ccc2c(N)nccc2c1 |
| InChI | InChI=1S/C25H37N5O2/c1-18(29-25(32)22(26)7-3-6-16-30-14-4-2-5-15-30)23(31)11-9-19-8-10-21-20(17-19)12-13-28-24(21)27/h8,10,12-13,17-18,22H,2-7,9,11,14-16,26H2,1H3,(H2,27,28)(H,29,32)/t18-,22+/m0/s1 |
| InChIKey | FRXLKTHDWPSLAJ-PGRDOPGGSA-N |
| XLogP | 2.81 |
| TPSA | 114.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.60 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|