C29H47N5O2 — CID 167682903
(2R)-N-[(2S)-5-(1-aminoisoquinolin-6-yl)-3-oxopentan-2-yl]-6-piperidin-1-yl-2-(propan-2-ylamino)hexanamide;methane (PubChem CID 167682903) has the molecular formula C29H47N5O2 and a molecular weight of 497.73 g/mol. Its IUPAC name is (2R)-N-[(2S)-5-(1-aminoisoquinolin-6-yl)-3-oxopentan-2-yl]-6-piperidin-1-yl-2-(propan-2-ylamino)hexanamide;methane.
| Compound Name | (2R)-N-[(2S)-5-(1-aminoisoquinolin-6-yl)-3-oxopentan-2-yl]-6-piperidin-1-yl-2-(propan-2-ylamino)hexanamide;methane |
|---|---|
| PubChem CID | 167682903 |
| Molecular Formula | C29H47N5O2 |
| Molecular Weight | 497.73 g/mol |
| Exact Mass | 497.37 |
| IUPAC Name | (2R)-N-[(2S)-5-(1-aminoisoquinolin-6-yl)-3-oxopentan-2-yl]-6-piperidin-1-yl-2-(propan-2-ylamino)hexanamide;methane |
| SMILES | C.CC(C)N[C@H](CCCCN1CCCCC1)C(=O)N[C@@H](C)C(=O)CCc1ccc2c(N)nccc2c1 |
| InChI | InChI=1S/C28H43N5O2.CH4/c1-20(2)31-25(9-5-8-18-33-16-6-4-7-17-33)28(35)32-21(3)26(34)13-11-22-10-12-24-23(19-22)14-15-30-27(24)29;/h10,12,14-15,19-21,25,31H,4-9,11,13,16-18H2,1-3H3,(H2,29,30)(H,32,35);1H4/t21-,25+;/m0./s1 |
| InChIKey | VUICTTMGZAVZNS-XSHMPXIGSA-N |
| XLogP | 4.48 |
| TPSA | 100.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.73 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|