C30H38N4O2 — CID 167674352
(2R)-N-[(2S)-5-(1-aminoisoquinolin-6-yl)-3-oxopentan-2-yl]-2-(cyclohexylamino)-4-phenylbutanamide (PubChem CID 167674352) has the molecular formula C30H38N4O2 and a molecular weight of 486.66 g/mol. Its IUPAC name is (2R)-N-[(2S)-5-(1-aminoisoquinolin-6-yl)-3-oxopentan-2-yl]-2-(cyclohexylamino)-4-phenylbutanamide.
| Compound Name | (2R)-N-[(2S)-5-(1-aminoisoquinolin-6-yl)-3-oxopentan-2-yl]-2-(cyclohexylamino)-4-phenylbutanamide |
|---|---|
| PubChem CID | 167674352 |
| Molecular Formula | C30H38N4O2 |
| Molecular Weight | 486.66 g/mol |
| Exact Mass | 486.30 |
| IUPAC Name | (2R)-N-[(2S)-5-(1-aminoisoquinolin-6-yl)-3-oxopentan-2-yl]-2-(cyclohexylamino)-4-phenylbutanamide |
| SMILES | C[C@H](NC(=O)[C@@H](CCc1ccccc1)NC1CCCCC1)C(=O)CCc1ccc2c(N)nccc2c1 |
| InChI | InChI=1S/C30H38N4O2/c1-21(28(35)17-14-23-12-15-26-24(20-23)18-19-32-29(26)31)33-30(36)27(34-25-10-6-3-7-11-25)16-13-22-8-4-2-5-9-22/h2,4-5,8-9,12,15,18-21,25,27,34H,3,6-7,10-11,13-14,16-17H2,1H3,(H2,31,32)(H,33,36)/t21-,27+/m0/s1 |
| InChIKey | NCAKJOOUFOURCH-KDYSTLNUSA-N |
| XLogP | 4.75 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.66 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |