C13H13ClN4O2 — CID 43617217
1-N-(6-chloro-3-nitro-2-pyridinyl)-4-N,4-N-dimethylbenzene-1,4-diamine (PubChem CID 43617217) has the molecular formula C13H13ClN4O2 and a molecular weight of 292.73 g/mol. Its IUPAC name is 1-N-(6-chloro-3-nitro-2-pyridinyl)-4-N,4-N-dimethylbenzene-1,4-diamine.
| Compound Name | 1-N-(6-chloro-3-nitro-2-pyridinyl)-4-N,4-N-dimethylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 43617217 |
| Molecular Formula | C13H13ClN4O2 |
| Molecular Weight | 292.73 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | 1-N-(6-chloro-3-nitro-2-pyridinyl)-4-N,4-N-dimethylbenzene-1,4-diamine |
| SMILES | CN(C)c1ccc(Nc2nc(Cl)ccc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C13H13ClN4O2/c1-17(2)10-5-3-9(4-6-10)15-13-11(18(19)20)7-8-12(14)16-13/h3-8H,1-2H3,(H,15,16) |
| InChIKey | SUJOKVVZUWZAPQ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 71.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.73 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|