C7H9ClN4O2 — CID 83020190
2-(6-chloro-3-nitro-2-pyridinyl)-1,1-dimethylhydrazine (PubChem CID 83020190) has the molecular formula C7H9ClN4O2 and a molecular weight of 216.63 g/mol. Its IUPAC name is 2-(6-chloro-3-nitro-2-pyridinyl)-1,1-dimethylhydrazine.
| Compound Name | 2-(6-chloro-3-nitro-2-pyridinyl)-1,1-dimethylhydrazine |
|---|---|
| PubChem CID | 83020190 |
| Molecular Formula | C7H9ClN4O2 |
| Molecular Weight | 216.63 g/mol |
| Exact Mass | 216.04 |
| IUPAC Name | 2-(6-chloro-3-nitro-2-pyridinyl)-1,1-dimethylhydrazine |
| SMILES | CN(C)Nc1nc(Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C7H9ClN4O2/c1-11(2)10-7-5(12(13)14)3-4-6(8)9-7/h3-4H,1-2H3,(H,9,10) |
| InChIKey | IBQZSMGEMZCCSW-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 71.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.63 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|