C8H10ClN3O6S2 — CID 104821425
N-(6-chloro-3-nitro-2-pyridinyl)-2-methylsulfonylethanesulfonamide (PubChem CID 104821425) has the molecular formula C8H10ClN3O6S2 and a molecular weight of 343.77 g/mol. Its IUPAC name is N-(6-chloro-3-nitro-2-pyridinyl)-2-methylsulfonylethanesulfonamide.
| Compound Name | N-(6-chloro-3-nitro-2-pyridinyl)-2-methylsulfonylethanesulfonamide |
|---|---|
| PubChem CID | 104821425 |
| Molecular Formula | C8H10ClN3O6S2 |
| Molecular Weight | 343.77 g/mol |
| Exact Mass | 342.97 |
| IUPAC Name | N-(6-chloro-3-nitro-2-pyridinyl)-2-methylsulfonylethanesulfonamide |
| SMILES | CS(=O)(=O)CCS(=O)(=O)Nc1nc(Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C8H10ClN3O6S2/c1-19(15,16)4-5-20(17,18)11-8-6(12(13)14)2-3-7(9)10-8/h2-3H,4-5H2,1H3,(H,10,11) |
| InChIKey | SNNVAIBQKWPVNC-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 136.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.77 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|