C15H16ClFN4O2 — CID 140572053
1-N-(6-chloro-3-nitro-2-pyridinyl)-4-N-ethyl-4-N-(2-fluoroethyl)benzene-1,4-diamine (PubChem CID 140572053) has the molecular formula C15H16ClFN4O2 and a molecular weight of 338.77 g/mol. Its IUPAC name is 1-N-(6-chloro-3-nitro-2-pyridinyl)-4-N-ethyl-4-N-(2-fluoroethyl)benzene-1,4-diamine.
| Compound Name | 1-N-(6-chloro-3-nitro-2-pyridinyl)-4-N-ethyl-4-N-(2-fluoroethyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 140572053 |
| Molecular Formula | C15H16ClFN4O2 |
| Molecular Weight | 338.77 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | 1-N-(6-chloro-3-nitro-2-pyridinyl)-4-N-ethyl-4-N-(2-fluoroethyl)benzene-1,4-diamine |
| SMILES | CCN(CCF)c1ccc(Nc2nc(Cl)ccc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C15H16ClFN4O2/c1-2-20(10-9-17)12-5-3-11(4-6-12)18-15-13(21(22)23)7-8-14(16)19-15/h3-8H,2,9-10H2,1H3,(H,18,19) |
| InChIKey | VQUJCFCFJIRGCB-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 71.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.77 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|