C21H25FN6O2 — CID 140572087
4-N-ethyl-4-N-(2-fluoroethyl)-1-N-[3-nitro-6-(2-propan-2-ylimidazol-1-yl)-2-pyridinyl]benzene-1,4-diamine (PubChem CID 140572087) has the molecular formula C21H25FN6O2 and a molecular weight of 412.47 g/mol. Its IUPAC name is 4-N-ethyl-4-N-(2-fluoroethyl)-1-N-[3-nitro-6-(2-propan-2-ylimidazol-1-yl)-2-pyridinyl]benzene-1,4-diamine.
| Compound Name | 4-N-ethyl-4-N-(2-fluoroethyl)-1-N-[3-nitro-6-(2-propan-2-ylimidazol-1-yl)-2-pyridinyl]benzene-1,4-diamine |
|---|---|
| PubChem CID | 140572087 |
| Molecular Formula | C21H25FN6O2 |
| Molecular Weight | 412.47 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | 4-N-ethyl-4-N-(2-fluoroethyl)-1-N-[3-nitro-6-(2-propan-2-ylimidazol-1-yl)-2-pyridinyl]benzene-1,4-diamine |
| SMILES | CCN(CCF)c1ccc(Nc2nc(-n3ccnc3C(C)C)ccc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H25FN6O2/c1-4-26(13-11-22)17-7-5-16(6-8-17)24-20-18(28(29)30)9-10-19(25-20)27-14-12-23-21(27)15(2)3/h5-10,12,14-15H,4,11,13H2,1-3H3,(H,24,25) |
| InChIKey | HMXMWCBDSCNADZ-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 89.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.47 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|