C13H14Cl2N2OS — CID 57461655
4-[3,5-dichloro-4-(2-methylpropoxy)phenyl]-1,3-thiazol-2-amine (PubChem CID 57461655) has the molecular formula C13H14Cl2N2OS and a molecular weight of 317.24 g/mol. Its IUPAC name is 4-[3,5-dichloro-4-(2-methylpropoxy)phenyl]-1,3-thiazol-2-amine.
| Compound Name | 4-[3,5-dichloro-4-(2-methylpropoxy)phenyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 57461655 |
| Molecular Formula | C13H14Cl2N2OS |
| Molecular Weight | 317.24 g/mol |
| Exact Mass | 316.02 |
| IUPAC Name | 4-[3,5-dichloro-4-(2-methylpropoxy)phenyl]-1,3-thiazol-2-amine |
| SMILES | CC(C)COc1c(Cl)cc(-c2csc(N)n2)cc1Cl |
| InChI | InChI=1S/C13H14Cl2N2OS/c1-7(2)5-18-12-9(14)3-8(4-10(12)15)11-6-19-13(16)17-11/h3-4,6-7H,5H2,1-2H3,(H2,16,17) |
| InChIKey | GVURXDAJRUFZMT-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.24 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |