C16H11Cl2N5O4S — CID 1367436
1-(3,4-dichlorophenyl)-3-[5-[(4-nitrophenoxy)methyl]-1,3,4-thiadiazol-2-yl]urea (PubChem CID 1367436) has the molecular formula C16H11Cl2N5O4S and a molecular weight of 440.27 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-3-[5-[(4-nitrophenoxy)methyl]-1,3,4-thiadiazol-2-yl]urea.
| Compound Name | 1-(3,4-dichlorophenyl)-3-[5-[(4-nitrophenoxy)methyl]-1,3,4-thiadiazol-2-yl]urea |
|---|---|
| PubChem CID | 1367436 |
| Molecular Formula | C16H11Cl2N5O4S |
| Molecular Weight | 440.27 g/mol |
| Exact Mass | 438.99 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-3-[5-[(4-nitrophenoxy)methyl]-1,3,4-thiadiazol-2-yl]urea |
| SMILES | O=C(Nc1ccc(Cl)c(Cl)c1)Nc1nnc(COc2ccc([N+](=O)[O-])cc2)s1 |
| InChI | InChI=1S/C16H11Cl2N5O4S/c17-12-6-1-9(7-13(12)18)19-15(24)20-16-22-21-14(28-16)8-27-11-4-2-10(3-5-11)23(25)26/h1-7H,8H2,(H2,19,20,22,24) |
| InChIKey | DOQFDWWAMGAVFS-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 119.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.27 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|