C15H20N4OS — CID 103361700
5-N-(2-cyclopentyloxyethyl)-4-pyridin-3-yl-1,2-thiazole-3,5-diamine (PubChem CID 103361700) has the molecular formula C15H20N4OS and a molecular weight of 304.42 g/mol. Its IUPAC name is 5-N-(2-cyclopentyloxyethyl)-4-pyridin-3-yl-1,2-thiazole-3,5-diamine.
| Compound Name | 5-N-(2-cyclopentyloxyethyl)-4-pyridin-3-yl-1,2-thiazole-3,5-diamine |
|---|---|
| PubChem CID | 103361700 |
| Molecular Formula | C15H20N4OS |
| Molecular Weight | 304.42 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | 5-N-(2-cyclopentyloxyethyl)-4-pyridin-3-yl-1,2-thiazole-3,5-diamine |
| SMILES | Nc1nsc(NCCOC2CCCC2)c1-c1cccnc1 |
| InChI | InChI=1S/C15H20N4OS/c16-14-13(11-4-3-7-17-10-11)15(21-19-14)18-8-9-20-12-5-1-2-6-12/h3-4,7,10,12,18H,1-2,5-6,8-9H2,(H2,16,19) |
| InChIKey | RBDQOLHHMZSVTC-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.42 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|