About 4-pyridin-3-yl-5-N-(2-pyridin-4-ylethyl)-1,2-thiazole-3,5-diamine
4-pyridin-3-yl-5-N-(2-pyridin-4-ylethyl)-1,2-thiazole-3,5-diamine (PubChem CID 103364167) has the molecular formula C15H15N5S
and a molecular weight of 297.39 g/mol. Its IUPAC name is 4-pyridin-3-yl-5-N-(2-pyridin-4-ylethyl)-1,2-thiazole-3,5-diamine.
Molecular Properties
| Compound Name | 4-pyridin-3-yl-5-N-(2-pyridin-4-ylethyl)-1,2-thiazole-3,5-diamine |
| PubChem CID | 103364167 |
| Molecular Formula | C15H15N5S |
| Molecular Weight | 297.39 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | 4-pyridin-3-yl-5-N-(2-pyridin-4-ylethyl)-1,2-thiazole-3,5-diamine |
| SMILES | Nc1nsc(NCCc2ccncc2)c1-c1cccnc1 |
| InChI | InChI=1S/C15H15N5S/c16-14-13(12-2-1-6-18-10-12)15(21-20-14)19-9-5-11-3-7-17-8-4-11/h1-4,6-8,10,19H,5,9H2,(H2,16,20) |
| InChIKey | OFDJJJYEPDGYMA-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.39 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-pyridin-3-yl-5-N-(2-pyridin-4-ylethyl)-1,2-thiazole-3,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-pyridin-3-yl-5-N-(2-pyridin-4-ylethyl)-1,2-thiazole-3,5-diamine?
The IUPAC name of 4-pyridin-3-yl-5-N-(2-pyridin-4-ylethyl)-1,2-thiazole-3,5-diamine (CID 103364167) is 4-pyridin-3-yl-5-N-(2-pyridin-4-ylethyl)-1,2-thiazole-3,5-diamine.
What is the SMILES notation for 4-pyridin-3-yl-5-N-(2-pyridin-4-ylethyl)-1,2-thiazole-3,5-diamine?
The canonical SMILES for 4-pyridin-3-yl-5-N-(2-pyridin-4-ylethyl)-1,2-thiazole-3,5-diamine is Nc1nsc(NCCc2ccncc2)c1-c1cccnc1.
What is the InChIKey of 4-pyridin-3-yl-5-N-(2-pyridin-4-ylethyl)-1,2-thiazole-3,5-diamine?
The InChIKey is OFDJJJYEPDGYMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15N5S/c16-14-13(12-2-1-6-18-10-12)15(21-20-14)19-9-5-11-3-7-17-8-4-11/h1-4,6-8,10,19H,5,9H2,(H2,16,20).
What are the key properties of 4-pyridin-3-yl-5-N-(2-pyridin-4-ylethyl)-1,2-thiazole-3,5-diamine?
4-pyridin-3-yl-5-N-(2-pyridin-4-ylethyl)-1,2-thiazole-3,5-diamine has a molecular weight of 297.39 g/mol, XLogP of 2.84, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-pyridin-3-yl-5-N-(2-pyridin-4-ylethyl)-1,2-thiazole-3,5-diamine is sourced from PubChem (CID 103364167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).