C9H10N4S — CID 103363370
5-N-methyl-4-pyridin-3-yl-1,2-thiazole-3,5-diamine (PubChem CID 103363370) has the molecular formula C9H10N4S and a molecular weight of 206.27 g/mol. Its IUPAC name is 5-N-methyl-4-pyridin-3-yl-1,2-thiazole-3,5-diamine.
| Compound Name | 5-N-methyl-4-pyridin-3-yl-1,2-thiazole-3,5-diamine |
|---|---|
| PubChem CID | 103363370 |
| Molecular Formula | C9H10N4S |
| Molecular Weight | 206.27 g/mol |
| Exact Mass | 206.06 |
| IUPAC Name | 5-N-methyl-4-pyridin-3-yl-1,2-thiazole-3,5-diamine |
| SMILES | CNc1snc(N)c1-c1cccnc1 |
| InChI | InChI=1S/C9H10N4S/c1-11-9-7(8(10)13-14-9)6-3-2-4-12-5-6/h2-5,11H,1H3,(H2,10,13) |
| InChIKey | RLFRCDXENCDFJD-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.27 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |