C14H18N4S — CID 103365334
5-N-(1-ethylcyclobutyl)-4-pyridin-3-yl-1,2-thiazole-3,5-diamine (PubChem CID 103365334) has the molecular formula C14H18N4S and a molecular weight of 274.39 g/mol. Its IUPAC name is 5-N-(1-ethylcyclobutyl)-4-pyridin-3-yl-1,2-thiazole-3,5-diamine.
| Compound Name | 5-N-(1-ethylcyclobutyl)-4-pyridin-3-yl-1,2-thiazole-3,5-diamine |
|---|---|
| PubChem CID | 103365334 |
| Molecular Formula | C14H18N4S |
| Molecular Weight | 274.39 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | 5-N-(1-ethylcyclobutyl)-4-pyridin-3-yl-1,2-thiazole-3,5-diamine |
| SMILES | CCC1(Nc2snc(N)c2-c2cccnc2)CCC1 |
| InChI | InChI=1S/C14H18N4S/c1-2-14(6-4-7-14)17-13-11(12(15)18-19-13)10-5-3-8-16-9-10/h3,5,8-9,17H,2,4,6-7H2,1H3,(H2,15,18) |
| InChIKey | RKJXGXKGPJXKPZ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.39 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |