C13H16N4S2 — CID 103364491
4-pyridin-3-yl-5-N-(thiolan-2-ylmethyl)-1,2-thiazole-3,5-diamine (PubChem CID 103364491) has the molecular formula C13H16N4S2 and a molecular weight of 292.43 g/mol. Its IUPAC name is 4-pyridin-3-yl-5-N-(thiolan-2-ylmethyl)-1,2-thiazole-3,5-diamine.
| Compound Name | 4-pyridin-3-yl-5-N-(thiolan-2-ylmethyl)-1,2-thiazole-3,5-diamine |
|---|---|
| PubChem CID | 103364491 |
| Molecular Formula | C13H16N4S2 |
| Molecular Weight | 292.43 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | 4-pyridin-3-yl-5-N-(thiolan-2-ylmethyl)-1,2-thiazole-3,5-diamine |
| SMILES | Nc1nsc(NCC2CCCS2)c1-c1cccnc1 |
| InChI | InChI=1S/C13H16N4S2/c14-12-11(9-3-1-5-15-7-9)13(19-17-12)16-8-10-4-2-6-18-10/h1,3,5,7,10,16H,2,4,6,8H2,(H2,14,17) |
| InChIKey | ZVNPKZLKVJRGKG-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.43 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |