C14H18N4OS — CID 103359235
5-N-(oxan-3-ylmethyl)-4-pyridin-3-yl-1,2-thiazole-3,5-diamine (PubChem CID 103359235) has the molecular formula C14H18N4OS and a molecular weight of 290.39 g/mol. Its IUPAC name is 5-N-(oxan-3-ylmethyl)-4-pyridin-3-yl-1,2-thiazole-3,5-diamine.
| Compound Name | 5-N-(oxan-3-ylmethyl)-4-pyridin-3-yl-1,2-thiazole-3,5-diamine |
|---|---|
| PubChem CID | 103359235 |
| Molecular Formula | C14H18N4OS |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | 5-N-(oxan-3-ylmethyl)-4-pyridin-3-yl-1,2-thiazole-3,5-diamine |
| SMILES | Nc1nsc(NCC2CCCOC2)c1-c1cccnc1 |
| InChI | InChI=1S/C14H18N4OS/c15-13-12(11-4-1-5-16-8-11)14(20-18-13)17-7-10-3-2-6-19-9-10/h1,4-5,8,10,17H,2-3,6-7,9H2,(H2,15,18) |
| InChIKey | MIIZQUPUDSWRLG-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |