C16H21N3S — CID 103382843
5-N-(cyclohexylmethyl)-4-phenyl-1,2-thiazole-3,5-diamine (PubChem CID 103382843) has the molecular formula C16H21N3S and a molecular weight of 287.43 g/mol. Its IUPAC name is 5-N-(cyclohexylmethyl)-4-phenyl-1,2-thiazole-3,5-diamine.
| Compound Name | 5-N-(cyclohexylmethyl)-4-phenyl-1,2-thiazole-3,5-diamine |
|---|---|
| PubChem CID | 103382843 |
| Molecular Formula | C16H21N3S |
| Molecular Weight | 287.43 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | 5-N-(cyclohexylmethyl)-4-phenyl-1,2-thiazole-3,5-diamine |
| SMILES | Nc1nsc(NCC2CCCCC2)c1-c1ccccc1 |
| InChI | InChI=1S/C16H21N3S/c17-15-14(13-9-5-2-6-10-13)16(20-19-15)18-11-12-7-3-1-4-8-12/h2,5-6,9-10,12,18H,1,3-4,7-8,11H2,(H2,17,19) |
| InChIKey | JXAPBJPASVSSDX-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.43 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |