C17H23N3S — CID 103378981
5-N-(4-ethylcyclohexyl)-4-phenyl-1,2-thiazole-3,5-diamine (PubChem CID 103378981) has the molecular formula C17H23N3S and a molecular weight of 301.46 g/mol. Its IUPAC name is 5-N-(4-ethylcyclohexyl)-4-phenyl-1,2-thiazole-3,5-diamine.
| Compound Name | 5-N-(4-ethylcyclohexyl)-4-phenyl-1,2-thiazole-3,5-diamine |
|---|---|
| PubChem CID | 103378981 |
| Molecular Formula | C17H23N3S |
| Molecular Weight | 301.46 g/mol |
| Exact Mass | 301.16 |
| IUPAC Name | 5-N-(4-ethylcyclohexyl)-4-phenyl-1,2-thiazole-3,5-diamine |
| SMILES | CCC1CCC(Nc2snc(N)c2-c2ccccc2)CC1 |
| InChI | InChI=1S/C17H23N3S/c1-2-12-8-10-14(11-9-12)19-17-15(16(18)20-21-17)13-6-4-3-5-7-13/h3-7,12,14,19H,2,8-11H2,1H3,(H2,18,20) |
| InChIKey | VUGVWQBLPOBFKJ-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.46 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |