C10H17N5O3S — CID 103384104
3-amino-5-[[3-(2-methoxyethylamino)-3-oxopropyl]amino]-1,2-thiazole-4-carboxamide (PubChem CID 103384104) has the molecular formula C10H17N5O3S and a molecular weight of 287.34 g/mol. Its IUPAC name is 3-amino-5-[[3-(2-methoxyethylamino)-3-oxopropyl]amino]-1,2-thiazole-4-carboxamide.
| Compound Name | 3-amino-5-[[3-(2-methoxyethylamino)-3-oxopropyl]amino]-1,2-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 103384104 |
| Molecular Formula | C10H17N5O3S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | 3-amino-5-[[3-(2-methoxyethylamino)-3-oxopropyl]amino]-1,2-thiazole-4-carboxamide |
| SMILES | COCCNC(=O)CCNc1snc(N)c1C(N)=O |
| InChI | InChI=1S/C10H17N5O3S/c1-18-5-4-13-6(16)2-3-14-10-7(9(12)17)8(11)15-19-10/h14H,2-5H2,1H3,(H2,11,15)(H2,12,17)(H,13,16) |
| InChIKey | IZAQGRUGOPOGRP-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 132.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|