C9H17N5O3 — CID 106964385
3-[[5-(aminomethyl)-1,3,4-oxadiazol-2-yl]amino]-N-(2-methoxyethyl)propanamide (PubChem CID 106964385) has the molecular formula C9H17N5O3 and a molecular weight of 243.27 g/mol. Its IUPAC name is 3-[[5-(aminomethyl)-1,3,4-oxadiazol-2-yl]amino]-N-(2-methoxyethyl)propanamide.
| Compound Name | 3-[[5-(aminomethyl)-1,3,4-oxadiazol-2-yl]amino]-N-(2-methoxyethyl)propanamide |
|---|---|
| PubChem CID | 106964385 |
| Molecular Formula | C9H17N5O3 |
| Molecular Weight | 243.27 g/mol |
| Exact Mass | 243.13 |
| IUPAC Name | 3-[[5-(aminomethyl)-1,3,4-oxadiazol-2-yl]amino]-N-(2-methoxyethyl)propanamide |
| SMILES | COCCNC(=O)CCNc1nnc(CN)o1 |
| InChI | InChI=1S/C9H17N5O3/c1-16-5-4-11-7(15)2-3-12-9-14-13-8(6-10)17-9/h2-6,10H2,1H3,(H,11,15)(H,12,14) |
| InChIKey | CTZQWCKQTCOZAE-UHFFFAOYSA-N |
| XLogP | -0.91 |
| TPSA | 115.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.27 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|