C11H17ClN6 — CID 104697610
3-N-(2-chloro-7H-purin-6-yl)-1-N,1-N-dimethylbutane-1,3-diamine (PubChem CID 104697610) has the molecular formula C11H17ClN6 and a molecular weight of 268.75 g/mol. Its IUPAC name is 3-N-(2-chloro-7H-purin-6-yl)-1-N,1-N-dimethylbutane-1,3-diamine.
| Compound Name | 3-N-(2-chloro-7H-purin-6-yl)-1-N,1-N-dimethylbutane-1,3-diamine |
|---|---|
| PubChem CID | 104697610 |
| Molecular Formula | C11H17ClN6 |
| Molecular Weight | 268.75 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | 3-N-(2-chloro-7H-purin-6-yl)-1-N,1-N-dimethylbutane-1,3-diamine |
| SMILES | CC(CCN(C)C)Nc1nc(Cl)nc2nc[nH]c12 |
| InChI | InChI=1S/C11H17ClN6/c1-7(4-5-18(2)3)15-10-8-9(14-6-13-8)16-11(12)17-10/h6-7H,4-5H2,1-3H3,(H2,13,14,15,16,17) |
| InChIKey | VRSJXCROEBVYOW-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 69.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.75 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |