C11H14ClN5O2 — CID 97266253
(2R,3R)-2-[(2-chloro-7H-purin-6-yl)amino]-3-methylpentanoic acid (PubChem CID 97266253) has the molecular formula C11H14ClN5O2 and a molecular weight of 283.72 g/mol. Its IUPAC name is (2R,3R)-2-[(2-chloro-7H-purin-6-yl)amino]-3-methylpentanoic acid.
| Compound Name | (2R,3R)-2-[(2-chloro-7H-purin-6-yl)amino]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 97266253 |
| Molecular Formula | C11H14ClN5O2 |
| Molecular Weight | 283.72 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | (2R,3R)-2-[(2-chloro-7H-purin-6-yl)amino]-3-methylpentanoic acid |
| SMILES | CC[C@@H](C)[C@@H](Nc1nc(Cl)nc2nc[nH]c12)C(=O)O |
| InChI | InChI=1S/C11H14ClN5O2/c1-3-5(2)6(10(18)19)15-9-7-8(14-4-13-7)16-11(12)17-9/h4-6H,3H2,1-2H3,(H,18,19)(H2,13,14,15,16,17)/t5-,6-/m1/s1 |
| InChIKey | HLYUIQOHIFBJOD-PHDIDXHHSA-N |
| XLogP | 1.92 |
| TPSA | 103.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.72 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |