About 1H-indazol-3-amine;methane
1H-indazol-3-amine;methane (PubChem CID 143158036) has the molecular formula C8H11N3
and a molecular weight of 149.20 g/mol. Its IUPAC name is 1H-indazol-3-amine;methane.
Molecular Properties
| Compound Name | 1H-indazol-3-amine;methane |
| PubChem CID | 143158036 |
| Molecular Formula | C8H11N3 |
| Molecular Weight | 149.20 g/mol |
| Exact Mass | 149.10 |
| IUPAC Name | 1H-indazol-3-amine;methane |
| SMILES | C.Nc1n[nH]c2ccccc12 |
| InChI | InChI=1S/C7H7N3.CH4/c8-7-5-3-1-2-4-6(5)9-10-7;/h1-4H,(H3,8,9,10);1H4 |
| InChIKey | OUFXJDHZMCNVGT-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.20 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1H-indazol-3-amine;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-indazol-3-amine;methane?
The IUPAC name of 1H-indazol-3-amine;methane (CID 143158036) is 1H-indazol-3-amine;methane.
What is the SMILES notation for 1H-indazol-3-amine;methane?
The canonical SMILES for 1H-indazol-3-amine;methane is C.Nc1n[nH]c2ccccc12.
What is the InChIKey of 1H-indazol-3-amine;methane?
The InChIKey is OUFXJDHZMCNVGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3.CH4/c8-7-5-3-1-2-4-6(5)9-10-7;/h1-4H,(H3,8,9,10);1H4.
What are the key properties of 1H-indazol-3-amine;methane?
1H-indazol-3-amine;methane has a molecular weight of 149.20 g/mol, XLogP of 1.78, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-indazol-3-amine;methane is sourced from PubChem (CID 143158036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).