About 1H-indazol-3-amine;quinoline
1H-indazol-3-amine;quinoline (PubChem CID 158589437) has the molecular formula C16H14N4
and a molecular weight of 262.32 g/mol. Its IUPAC name is 1H-indazol-3-amine;quinoline.
Molecular Properties
| Compound Name | 1H-indazol-3-amine;quinoline |
| PubChem CID | 158589437 |
| Molecular Formula | C16H14N4 |
| Molecular Weight | 262.32 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | 1H-indazol-3-amine;quinoline |
| SMILES | Nc1n[nH]c2ccccc12.c1ccc2ncccc2c1 |
| InChI | InChI=1S/C9H7N.C7H7N3/c1-2-6-9-8(4-1)5-3-7-10-9;8-7-5-3-1-2-4-6(5)9-10-7/h1-7H;1-4H,(H3,8,9,10) |
| InChIKey | HUGLNRIGBIKEGP-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.32 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1H-indazol-3-amine;quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-indazol-3-amine;quinoline?
The IUPAC name of 1H-indazol-3-amine;quinoline (CID 158589437) is 1H-indazol-3-amine;quinoline.
What is the SMILES notation for 1H-indazol-3-amine;quinoline?
The canonical SMILES for 1H-indazol-3-amine;quinoline is Nc1n[nH]c2ccccc12.c1ccc2ncccc2c1.
What is the InChIKey of 1H-indazol-3-amine;quinoline?
The InChIKey is HUGLNRIGBIKEGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N.C7H7N3/c1-2-6-9-8(4-1)5-3-7-10-9;8-7-5-3-1-2-4-6(5)9-10-7/h1-7H;1-4H,(H3,8,9,10).
What are the key properties of 1H-indazol-3-amine;quinoline?
1H-indazol-3-amine;quinoline has a molecular weight of 262.32 g/mol, XLogP of 3.38, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-indazol-3-amine;quinoline is sourced from PubChem (CID 158589437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).