About tert-butyl formate;1H-indazol-3-amine
tert-butyl formate;1H-indazol-3-amine (PubChem CID 174833143) has the molecular formula C12H17N3O2
and a molecular weight of 235.29 g/mol. Its IUPAC name is tert-butyl formate;1H-indazol-3-amine.
Molecular Properties
| Compound Name | tert-butyl formate;1H-indazol-3-amine |
| PubChem CID | 174833143 |
| Molecular Formula | C12H17N3O2 |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.13 |
| IUPAC Name | tert-butyl formate;1H-indazol-3-amine |
| SMILES | CC(C)(C)OC=O.Nc1n[nH]c2ccccc12 |
| InChI | InChI=1S/C7H7N3.C5H10O2/c8-7-5-3-1-2-4-6(5)9-10-7;1-5(2,3)7-4-6/h1-4H,(H3,8,9,10);4H,1-3H3 |
| InChIKey | KOSWXXOUPZBCQN-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl formate;1H-indazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl formate;1H-indazol-3-amine?
The IUPAC name of tert-butyl formate;1H-indazol-3-amine (CID 174833143) is tert-butyl formate;1H-indazol-3-amine.
What is the SMILES notation for tert-butyl formate;1H-indazol-3-amine?
The canonical SMILES for tert-butyl formate;1H-indazol-3-amine is CC(C)(C)OC=O.Nc1n[nH]c2ccccc12.
What is the InChIKey of tert-butyl formate;1H-indazol-3-amine?
The InChIKey is KOSWXXOUPZBCQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3.C5H10O2/c8-7-5-3-1-2-4-6(5)9-10-7;1-5(2,3)7-4-6/h1-4H,(H3,8,9,10);4H,1-3H3.
What are the key properties of tert-butyl formate;1H-indazol-3-amine?
tert-butyl formate;1H-indazol-3-amine has a molecular weight of 235.29 g/mol, XLogP of 2.10, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl formate;1H-indazol-3-amine is sourced from PubChem (CID 174833143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).