C21H24N2O4 — CID 159625660
tert-butyl formate;1-(5-phenylmethoxy-1H-indazol-3-yl)ethanone (PubChem CID 159625660) has the molecular formula C21H24N2O4 and a molecular weight of 368.43 g/mol. Its IUPAC name is tert-butyl formate;1-(5-phenylmethoxy-1H-indazol-3-yl)ethanone.
| Compound Name | tert-butyl formate;1-(5-phenylmethoxy-1H-indazol-3-yl)ethanone |
|---|---|
| PubChem CID | 159625660 |
| Molecular Formula | C21H24N2O4 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | tert-butyl formate;1-(5-phenylmethoxy-1H-indazol-3-yl)ethanone |
| SMILES | CC(=O)c1n[nH]c2ccc(OCc3ccccc3)cc12.CC(C)(C)OC=O |
| InChI | InChI=1S/C16H14N2O2.C5H10O2/c1-11(19)16-14-9-13(7-8-15(14)17-18-16)20-10-12-5-3-2-4-6-12;1-5(2,3)7-4-6/h2-9H,10H2,1H3,(H,17,18);4H,1-3H3 |
| InChIKey | MOLMJTIKEJCKFO-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 81.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|