C26H27N5O2 — CID 46244124
4-(4-methylpiperazin-1-yl)-N-(5-phenylmethoxy-1H-indazol-3-yl)benzamide (PubChem CID 46244124) has the molecular formula C26H27N5O2 and a molecular weight of 441.54 g/mol. Its IUPAC name is 4-(4-methylpiperazin-1-yl)-N-(5-phenylmethoxy-1H-indazol-3-yl)benzamide.
| Compound Name | 4-(4-methylpiperazin-1-yl)-N-(5-phenylmethoxy-1H-indazol-3-yl)benzamide |
|---|---|
| PubChem CID | 46244124 |
| Molecular Formula | C26H27N5O2 |
| Molecular Weight | 441.54 g/mol |
| Exact Mass | 441.22 |
| IUPAC Name | 4-(4-methylpiperazin-1-yl)-N-(5-phenylmethoxy-1H-indazol-3-yl)benzamide |
| SMILES | CN1CCN(c2ccc(C(=O)Nc3n[nH]c4ccc(OCc5ccccc5)cc34)cc2)CC1 |
| InChI | InChI=1S/C26H27N5O2/c1-30-13-15-31(16-14-30)21-9-7-20(8-10-21)26(32)27-25-23-17-22(11-12-24(23)28-29-25)33-18-19-5-3-2-4-6-19/h2-12,17H,13-16,18H2,1H3,(H2,27,28,29,32) |
| InChIKey | FPXDLDKBTHGTGX-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 73.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.54 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |