C31H35F2N5O3 — CID 58513769
N-[5-[(3,5-difluorophenyl)methoxy]-1H-indazol-3-yl]-2-(4-methoxybutyl)-4-(4-methylpiperazin-1-yl)benzamide (PubChem CID 58513769) has the molecular formula C31H35F2N5O3 and a molecular weight of 563.65 g/mol. Its IUPAC name is N-[5-[(3,5-difluorophenyl)methoxy]-1H-indazol-3-yl]-2-(4-methoxybutyl)-4-(4-methylpiperazin-1-yl)benzamide.
| Compound Name | N-[5-[(3,5-difluorophenyl)methoxy]-1H-indazol-3-yl]-2-(4-methoxybutyl)-4-(4-methylpiperazin-1-yl)benzamide |
|---|---|
| PubChem CID | 58513769 |
| Molecular Formula | C31H35F2N5O3 |
| Molecular Weight | 563.65 g/mol |
| Exact Mass | 563.27 |
| IUPAC Name | N-[5-[(3,5-difluorophenyl)methoxy]-1H-indazol-3-yl]-2-(4-methoxybutyl)-4-(4-methylpiperazin-1-yl)benzamide |
| SMILES | COCCCCc1cc(N2CCN(C)CC2)ccc1C(=O)Nc1n[nH]c2ccc(OCc3cc(F)cc(F)c3)cc12 |
| InChI | InChI=1S/C31H35F2N5O3/c1-37-10-12-38(13-11-37)25-6-8-27(22(17-25)5-3-4-14-40-2)31(39)34-30-28-19-26(7-9-29(28)35-36-30)41-20-21-15-23(32)18-24(33)16-21/h6-9,15-19H,3-5,10-14,20H2,1-2H3,(H2,34,35,36,39) |
| InChIKey | RJHKZWYTXQWYMA-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 82.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.65 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|