C21H16F2N4O2 — CID 46244302
4-amino-N-[5-[(3,5-difluorophenyl)methoxy]-1H-indazol-3-yl]benzamide (PubChem CID 46244302) has the molecular formula C21H16F2N4O2 and a molecular weight of 394.38 g/mol. Its IUPAC name is 4-amino-N-[5-[(3,5-difluorophenyl)methoxy]-1H-indazol-3-yl]benzamide.
| Compound Name | 4-amino-N-[5-[(3,5-difluorophenyl)methoxy]-1H-indazol-3-yl]benzamide |
|---|---|
| PubChem CID | 46244302 |
| Molecular Formula | C21H16F2N4O2 |
| Molecular Weight | 394.38 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | 4-amino-N-[5-[(3,5-difluorophenyl)methoxy]-1H-indazol-3-yl]benzamide |
| SMILES | Nc1ccc(C(=O)Nc2n[nH]c3ccc(OCc4cc(F)cc(F)c4)cc23)cc1 |
| InChI | InChI=1S/C21H16F2N4O2/c22-14-7-12(8-15(23)9-14)11-29-17-5-6-19-18(10-17)20(27-26-19)25-21(28)13-1-3-16(24)4-2-13/h1-10H,11,24H2,(H2,25,26,27,28) |
| InChIKey | DIQZTSAJFVIYJX-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 93.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.38 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|