C23H19F2N3O2 — CID 70669783
N-[5-[(3,5-difluorophenyl)methoxy]-1H-indazol-3-yl]-3-ethylbenzamide (PubChem CID 70669783) has the molecular formula C23H19F2N3O2 and a molecular weight of 407.42 g/mol. Its IUPAC name is N-[5-[(3,5-difluorophenyl)methoxy]-1H-indazol-3-yl]-3-ethylbenzamide.
| Compound Name | N-[5-[(3,5-difluorophenyl)methoxy]-1H-indazol-3-yl]-3-ethylbenzamide |
|---|---|
| PubChem CID | 70669783 |
| Molecular Formula | C23H19F2N3O2 |
| Molecular Weight | 407.42 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | N-[5-[(3,5-difluorophenyl)methoxy]-1H-indazol-3-yl]-3-ethylbenzamide |
| SMILES | CCc1cccc(C(=O)Nc2n[nH]c3ccc(OCc4cc(F)cc(F)c4)cc23)c1 |
| InChI | InChI=1S/C23H19F2N3O2/c1-2-14-4-3-5-16(8-14)23(29)26-22-20-12-19(6-7-21(20)27-28-22)30-13-15-9-17(24)11-18(25)10-15/h3-12H,2,13H2,1H3,(H2,26,27,28,29) |
| InChIKey | VMRLPMOZOKTUGB-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.42 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |