C20H14FN3O4S — CID 22567287
(3-benzamido-1H-indazol-5-yl) 3-fluorobenzenesulfonate (PubChem CID 22567287) has the molecular formula C20H14FN3O4S and a molecular weight of 411.41 g/mol. Its IUPAC name is (3-benzamido-1H-indazol-5-yl) 3-fluorobenzenesulfonate.
| Compound Name | (3-benzamido-1H-indazol-5-yl) 3-fluorobenzenesulfonate |
|---|---|
| PubChem CID | 22567287 |
| Molecular Formula | C20H14FN3O4S |
| Molecular Weight | 411.41 g/mol |
| Exact Mass | 411.07 |
| IUPAC Name | (3-benzamido-1H-indazol-5-yl) 3-fluorobenzenesulfonate |
| SMILES | O=C(Nc1n[nH]c2ccc(OS(=O)(=O)c3cccc(F)c3)cc12)c1ccccc1 |
| InChI | InChI=1S/C20H14FN3O4S/c21-14-7-4-8-16(11-14)29(26,27)28-15-9-10-18-17(12-15)19(24-23-18)22-20(25)13-5-2-1-3-6-13/h1-12H,(H2,22,23,24,25) |
| InChIKey | FGYCOGBDHUFJQE-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.41 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|