C21H16FN3O2 — CID 86219903
2-fluoro-N-(5-phenylmethoxy-1H-indazol-3-yl)benzamide (PubChem CID 86219903) has the molecular formula C21H16FN3O2 and a molecular weight of 361.38 g/mol. Its IUPAC name is 2-fluoro-N-(5-phenylmethoxy-1H-indazol-3-yl)benzamide.
| Compound Name | 2-fluoro-N-(5-phenylmethoxy-1H-indazol-3-yl)benzamide |
|---|---|
| PubChem CID | 86219903 |
| Molecular Formula | C21H16FN3O2 |
| Molecular Weight | 361.38 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | 2-fluoro-N-(5-phenylmethoxy-1H-indazol-3-yl)benzamide |
| SMILES | O=C(Nc1n[nH]c2ccc(OCc3ccccc3)cc12)c1ccccc1F |
| InChI | InChI=1S/C21H16FN3O2/c22-18-9-5-4-8-16(18)21(26)23-20-17-12-15(10-11-19(17)24-25-20)27-13-14-6-2-1-3-7-14/h1-12H,13H2,(H2,23,24,25,26) |
| InChIKey | ZWZDQMQBWGKQSR-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.38 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |